C30H32F2N8O6 — CID 146349334
[(E,2S)-1-[[1-[[6-[(2,4-difluorophenyl)methoxy]-7H-purin-8-yl]methyl]-2-oxo-3-pyridinyl]amino]-7-(dimethylamino)-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate (PubChem CID 146349334) has the molecular formula C30H32F2N8O6 and a molecular weight of 638.63 g/mol. Its IUPAC name is [(E,2S)-1-[[1-[[6-[(2,4-difluorophenyl)methoxy]-7H-purin-8-yl]methyl]-2-oxo-3-pyridinyl]amino]-7-(dimethylamino)-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate.
| Compound Name | [(E,2S)-1-[[1-[[6-[(2,4-difluorophenyl)methoxy]-7H-purin-8-yl]methyl]-2-oxo-3-pyridinyl]amino]-7-(dimethylamino)-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 146349334 |
| Molecular Formula | C30H32F2N8O6 |
| Molecular Weight | 638.63 g/mol |
| Exact Mass | 638.24 |
| IUPAC Name | [(E,2S)-1-[[1-[[6-[(2,4-difluorophenyl)methoxy]-7H-purin-8-yl]methyl]-2-oxo-3-pyridinyl]amino]-7-(dimethylamino)-1,7-dioxohept-5-en-2-yl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)/C=C/CC[C@H](OC(=O)N(C)C)C(=O)Nc1cccn(Cc2nc3ncnc(OCc4ccc(F)cc4F)c3[nH]2)c1=O |
| InChI | InChI=1S/C30H32F2N8O6/c1-38(2)24(41)10-6-5-9-22(46-30(44)39(3)4)27(42)35-21-8-7-13-40(29(21)43)15-23-36-25-26(37-23)33-17-34-28(25)45-16-18-11-12-19(31)14-20(18)32/h6-8,10-14,17,22H,5,9,15-16H2,1-4H3,(H,35,42)(H,33,34,36,37)/b10-6+/t22-/m0/s1 |
| InChIKey | JNZGJDWWWJPZCQ-FLVSMNSFSA-N |
| XLogP | 2.85 |
| TPSA | 164.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.63 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|