C17H17ClF6N2O2 — CID 146349412
tert-butyl 2-(chloromethyl)-4-[3,3,3-trifluoro-2-(trifluoromethyl)propyl]benzimidazole-1-carboxylate (PubChem CID 146349412) has the molecular formula C17H17ClF6N2O2 and a molecular weight of 430.78 g/mol. Its IUPAC name is tert-butyl 2-(chloromethyl)-4-[3,3,3-trifluoro-2-(trifluoromethyl)propyl]benzimidazole-1-carboxylate.
| Compound Name | tert-butyl 2-(chloromethyl)-4-[3,3,3-trifluoro-2-(trifluoromethyl)propyl]benzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 146349412 |
| Molecular Formula | C17H17ClF6N2O2 |
| Molecular Weight | 430.78 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | tert-butyl 2-(chloromethyl)-4-[3,3,3-trifluoro-2-(trifluoromethyl)propyl]benzimidazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(CCl)nc2c(CC(C(F)(F)F)C(F)(F)F)cccc21 |
| InChI | InChI=1S/C17H17ClF6N2O2/c1-15(2,3)28-14(27)26-10-6-4-5-9(13(10)25-12(26)8-18)7-11(16(19,20)21)17(22,23)24/h4-6,11H,7-8H2,1-3H3 |
| InChIKey | YEUKGSLTRZYOIX-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.78 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|