C25H25ClO4 — CID 146349864
(3S,3'R,4'S,5'S,6'R)-6-chloro-6'-methyl-5-(naphthalen-2-ylmethyl)spiro[1,2-dihydroindene-3,2'-oxane]-3',4',5'-triol (PubChem CID 146349864) has the molecular formula C25H25ClO4 and a molecular weight of 424.92 g/mol. Its IUPAC name is (3S,3'R,4'S,5'S,6'R)-6-chloro-6'-methyl-5-(naphthalen-2-ylmethyl)spiro[1,2-dihydroindene-3,2'-oxane]-3',4',5'-triol.
| Compound Name | (3S,3'R,4'S,5'S,6'R)-6-chloro-6'-methyl-5-(naphthalen-2-ylmethyl)spiro[1,2-dihydroindene-3,2'-oxane]-3',4',5'-triol |
|---|---|
| PubChem CID | 146349864 |
| Molecular Formula | C25H25ClO4 |
| Molecular Weight | 424.92 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | (3S,3'R,4'S,5'S,6'R)-6-chloro-6'-methyl-5-(naphthalen-2-ylmethyl)spiro[1,2-dihydroindene-3,2'-oxane]-3',4',5'-triol |
| SMILES | C[C@H]1O[C@]2(CCc3cc(Cl)c(Cc4ccc5ccccc5c4)cc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H25ClO4/c1-14-22(27)23(28)24(29)25(30-14)9-8-18-13-21(26)19(12-20(18)25)11-15-6-7-16-4-2-3-5-17(16)10-15/h2-7,10,12-14,22-24,27-29H,8-9,11H2,1H3/t14-,22-,23+,24-,25+/m1/s1 |
| InChIKey | HFTYQMMAKQSNAT-HQRMJRMSSA-N |
| XLogP | 3.73 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.92 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |