C47H86N2 — CID 146350038
5-methylidene-9-N,9-N-bis[(9Z,12Z)-octadeca-9,12-dienyl]dec-9-ene-1,9-diamine (PubChem CID 146350038) has the molecular formula C47H86N2 and a molecular weight of 679.22 g/mol. Its IUPAC name is 5-methylidene-9-N,9-N-bis[(9Z,12Z)-octadeca-9,12-dienyl]dec-9-ene-1,9-diamine.
| Compound Name | 5-methylidene-9-N,9-N-bis[(9Z,12Z)-octadeca-9,12-dienyl]dec-9-ene-1,9-diamine |
|---|---|
| PubChem CID | 146350038 |
| Molecular Formula | C47H86N2 |
| Molecular Weight | 679.22 g/mol |
| Exact Mass | 678.68 |
| IUPAC Name | 5-methylidene-9-N,9-N-bis[(9Z,12Z)-octadeca-9,12-dienyl]dec-9-ene-1,9-diamine |
| SMILES | C=C(CCCCN)CCCC(=C)N(CCCCCCCC/C=C\C/C=C\CCCCC)CCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C47H86N2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-37-44-49(47(4)42-39-41-46(3)40-35-36-43-48)45-38-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22H,3-12,17-18,23-45,48H2,1-2H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | SAXOQPTVRKDURM-KWXKLSQISA-N |
| XLogP | 15.28 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.22 |
| LogP ≤ 5 | 15.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|