C27H44O4Si — CID 14635023
5-[2-[tert-butyl(dimethyl)silyl]oxy-2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-2-methoxy-3-propan-2-ylcyclohexa-2,5-diene-1,4-dione (PubChem CID 14635023) has the molecular formula C27H44O4Si and a molecular weight of 460.73 g/mol. Its IUPAC name is 5-[2-[tert-butyl(dimethyl)silyl]oxy-2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-2-methoxy-3-propan-2-ylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 5-[2-[tert-butyl(dimethyl)silyl]oxy-2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-2-methoxy-3-propan-2-ylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 14635023 |
| Molecular Formula | C27H44O4Si |
| Molecular Weight | 460.73 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | 5-[2-[tert-butyl(dimethyl)silyl]oxy-2-(2,6,6-trimethylcyclohexen-1-yl)ethyl]-2-methoxy-3-propan-2-ylcyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(C(C)C)C(=O)C(CC(O[Si](C)(C)C(C)(C)C)C2=C(C)CCCC2(C)C)=CC1=O |
| InChI | InChI=1S/C27H44O4Si/c1-17(2)22-24(29)19(15-20(28)25(22)30-9)16-21(31-32(10,11)26(4,5)6)23-18(3)13-12-14-27(23,7)8/h15,17,21H,12-14,16H2,1-11H3 |
| InChIKey | IXYJOIPFXVVNKD-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.73 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|