About 3-(1,3-benzothiazol-4-yl)-5-(6-fluoro-1H-indol-4-yl)-4-propan-2-yl-1H-pyrrole-2-carboxylic acid
3-(1,3-benzothiazol-4-yl)-5-(6-fluoro-1H-indol-4-yl)-4-propan-2-yl-1H-pyrrole-2-carboxylic acid (PubChem CID 146350247) has the molecular formula C23H18FN3O2S
and a molecular weight of 419.48 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-4-yl)-5-(6-fluoro-1H-indol-4-yl)-4-propan-2-yl-1H-pyrrole-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-(1,3-benzothiazol-4-yl)-5-(6-fluoro-1H-indol-4-yl)-4-propan-2-yl-1H-pyrrole-2-carboxylic acid |
| PubChem CID | 146350247 |
| Molecular Formula | C23H18FN3O2S |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 3-(1,3-benzothiazol-4-yl)-5-(6-fluoro-1H-indol-4-yl)-4-propan-2-yl-1H-pyrrole-2-carboxylic acid |
| SMILES | CC(C)c1c(-c2cc(F)cc3[nH]ccc23)[nH]c(C(=O)O)c1-c1cccc2scnc12 |
| InChI | InChI=1S/C23H18FN3O2S/c1-11(2)18-19(14-4-3-5-17-20(14)26-10-30-17)22(23(28)29)27-21(18)15-8-12(24)9-16-13(15)6-7-25-16/h3-11,25,27H,1-2H3,(H,28,29) |
| InChIKey | COTOIIBLHWHHBN-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 81.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1,3-benzothiazol-4-yl)-5-(6-fluoro-1H-indol-4-yl)-4-propan-2-yl-1H-pyrrole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-benzothiazol-4-yl)-5-(6-fluoro-1H-indol-4-yl)-4-propan-2-yl-1H-pyrrole-2-carboxylic acid?
The IUPAC name of 3-(1,3-benzothiazol-4-yl)-5-(6-fluoro-1H-indol-4-yl)-4-propan-2-yl-1H-pyrrole-2-carboxylic acid (CID 146350247) is 3-(1,3-benzothiazol-4-yl)-5-(6-fluoro-1H-indol-4-yl)-4-propan-2-yl-1H-pyrrole-2-carboxylic acid.
What is the SMILES notation for 3-(1,3-benzothiazol-4-yl)-5-(6-fluoro-1H-indol-4-yl)-4-propan-2-yl-1H-pyrrole-2-carboxylic acid?
The canonical SMILES for 3-(1,3-benzothiazol-4-yl)-5-(6-fluoro-1H-indol-4-yl)-4-propan-2-yl-1H-pyrrole-2-carboxylic acid is CC(C)c1c(-c2cc(F)cc3[nH]ccc23)[nH]c(C(=O)O)c1-c1cccc2scnc12.
What is the InChIKey of 3-(1,3-benzothiazol-4-yl)-5-(6-fluoro-1H-indol-4-yl)-4-propan-2-yl-1H-pyrrole-2-carboxylic acid?
The InChIKey is COTOIIBLHWHHBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18FN3O2S/c1-11(2)18-19(14-4-3-5-17-20(14)26-10-30-17)22(23(28)29)27-21(18)15-8-12(24)9-16-13(15)6-7-25-16/h3-11,25,27H,1-2H3,(H,28,29).
What are the key properties of 3-(1,3-benzothiazol-4-yl)-5-(6-fluoro-1H-indol-4-yl)-4-propan-2-yl-1H-pyrrole-2-carboxylic acid?
3-(1,3-benzothiazol-4-yl)-5-(6-fluoro-1H-indol-4-yl)-4-propan-2-yl-1H-pyrrole-2-carboxylic acid has a molecular weight of 419.48 g/mol, XLogP of 6.40, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzothiazol-4-yl)-5-(6-fluoro-1H-indol-4-yl)-4-propan-2-yl-1H-pyrrole-2-carboxylic acid is sourced from PubChem (CID 146350247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).