C16H18ClN7S — CID 146350497
6-chloro-2-(4-methylpiperazin-1-yl)-N-(1,3-thiazol-2-ylmethyl)pyrido[3,4-d]pyrimidin-4-amine (PubChem CID 146350497) has the molecular formula C16H18ClN7S and a molecular weight of 375.89 g/mol. Its IUPAC name is 6-chloro-2-(4-methylpiperazin-1-yl)-N-(1,3-thiazol-2-ylmethyl)pyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | 6-chloro-2-(4-methylpiperazin-1-yl)-N-(1,3-thiazol-2-ylmethyl)pyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 146350497 |
| Molecular Formula | C16H18ClN7S |
| Molecular Weight | 375.89 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 6-chloro-2-(4-methylpiperazin-1-yl)-N-(1,3-thiazol-2-ylmethyl)pyrido[3,4-d]pyrimidin-4-amine |
| SMILES | CN1CCN(c2nc(NCc3nccs3)c3cc(Cl)ncc3n2)CC1 |
| InChI | InChI=1S/C16H18ClN7S/c1-23-3-5-24(6-4-23)16-21-12-9-19-13(17)8-11(12)15(22-16)20-10-14-18-2-7-25-14/h2,7-9H,3-6,10H2,1H3,(H,20,21,22) |
| InChIKey | SPOGRKATCZSTCI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.89 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|