C17H20ClN7S — CID 146350601
6-chloro-2-(4-methylpiperazin-1-yl)-N-[2-(1,3-thiazol-2-yl)ethyl]pyrido[3,4-d]pyrimidin-4-amine (PubChem CID 146350601) has the molecular formula C17H20ClN7S and a molecular weight of 389.92 g/mol. Its IUPAC name is 6-chloro-2-(4-methylpiperazin-1-yl)-N-[2-(1,3-thiazol-2-yl)ethyl]pyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | 6-chloro-2-(4-methylpiperazin-1-yl)-N-[2-(1,3-thiazol-2-yl)ethyl]pyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 146350601 |
| Molecular Formula | C17H20ClN7S |
| Molecular Weight | 389.92 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 6-chloro-2-(4-methylpiperazin-1-yl)-N-[2-(1,3-thiazol-2-yl)ethyl]pyrido[3,4-d]pyrimidin-4-amine |
| SMILES | CN1CCN(c2nc(NCCc3nccs3)c3cc(Cl)ncc3n2)CC1 |
| InChI | InChI=1S/C17H20ClN7S/c1-24-5-7-25(8-6-24)17-22-13-11-21-14(18)10-12(13)16(23-17)20-3-2-15-19-4-9-26-15/h4,9-11H,2-3,5-8H2,1H3,(H,20,22,23) |
| InChIKey | MIEDMLKBXRPZHG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.92 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|