C28H35N3O3S — CID 146351036
[(2S,3R)-2,3-dimethyl-1-[4-[3-methyl-2-[(8-methyl-1,2,3,4-tetrahydroisoquinolin-6-yl)methoxy]phenyl]-1,3-thiazol-2-yl]pyrrolidin-3-yl]methanediol (PubChem CID 146351036) has the molecular formula C28H35N3O3S and a molecular weight of 493.67 g/mol. Its IUPAC name is [(2S,3R)-2,3-dimethyl-1-[4-[3-methyl-2-[(8-methyl-1,2,3,4-tetrahydroisoquinolin-6-yl)methoxy]phenyl]-1,3-thiazol-2-yl]pyrrolidin-3-yl]methanediol.
| Compound Name | [(2S,3R)-2,3-dimethyl-1-[4-[3-methyl-2-[(8-methyl-1,2,3,4-tetrahydroisoquinolin-6-yl)methoxy]phenyl]-1,3-thiazol-2-yl]pyrrolidin-3-yl]methanediol |
|---|---|
| PubChem CID | 146351036 |
| Molecular Formula | C28H35N3O3S |
| Molecular Weight | 493.67 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | [(2S,3R)-2,3-dimethyl-1-[4-[3-methyl-2-[(8-methyl-1,2,3,4-tetrahydroisoquinolin-6-yl)methoxy]phenyl]-1,3-thiazol-2-yl]pyrrolidin-3-yl]methanediol |
| SMILES | Cc1cc(COc2c(C)cccc2-c2csc(N3CC[C@@](C)(C(O)O)[C@@H]3C)n2)cc2c1CNCC2 |
| InChI | InChI=1S/C28H35N3O3S/c1-17-6-5-7-22(24-16-35-27(30-24)31-11-9-28(4,19(31)3)26(32)33)25(17)34-15-20-12-18(2)23-14-29-10-8-21(23)13-20/h5-7,12-13,16,19,26,29,32-33H,8-11,14-15H2,1-4H3/t19-,28+/m0/s1 |
| InChIKey | KYCSGRZIMUTMNG-HMILPKGGSA-N |
| XLogP | 4.57 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.67 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|