C33H40N4O2 — CID 146351060
7-[[2-[6-[(1S,5R)-3,6-diazabicyclo[3.1.0]hexan-3-yl]-2-pyridinyl]-6-methylphenoxy]methyl]-9-methyl-2-(oxan-4-yl)-1,3,4,5-tetrahydro-2-benzazepine (PubChem CID 146351060) has the molecular formula C33H40N4O2 and a molecular weight of 524.71 g/mol. Its IUPAC name is 7-[[2-[6-[(1S,5R)-3,6-diazabicyclo[3.1.0]hexan-3-yl]-2-pyridinyl]-6-methylphenoxy]methyl]-9-methyl-2-(oxan-4-yl)-1,3,4,5-tetrahydro-2-benzazepine.
| Compound Name | 7-[[2-[6-[(1S,5R)-3,6-diazabicyclo[3.1.0]hexan-3-yl]-2-pyridinyl]-6-methylphenoxy]methyl]-9-methyl-2-(oxan-4-yl)-1,3,4,5-tetrahydro-2-benzazepine |
|---|---|
| PubChem CID | 146351060 |
| Molecular Formula | C33H40N4O2 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.32 |
| IUPAC Name | 7-[[2-[6-[(1S,5R)-3,6-diazabicyclo[3.1.0]hexan-3-yl]-2-pyridinyl]-6-methylphenoxy]methyl]-9-methyl-2-(oxan-4-yl)-1,3,4,5-tetrahydro-2-benzazepine |
| SMILES | Cc1cc(COc2c(C)cccc2-c2cccc(N3C[C@@H]4N[C@@H]4C3)n2)cc2c1CN(C1CCOCC1)CCC2 |
| InChI | InChI=1S/C33H40N4O2/c1-22-6-3-8-27(29-9-4-10-32(35-29)37-19-30-31(20-37)34-30)33(22)39-21-24-16-23(2)28-18-36(13-5-7-25(28)17-24)26-11-14-38-15-12-26/h3-4,6,8-10,16-17,26,30-31,34H,5,7,11-15,18-21H2,1-2H3/t30-,31+ |
| InChIKey | IVPOAMITHJQORE-QRRGNZNSSA-N |
| XLogP | 5.03 |
| TPSA | 59.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|