C32H34FN3O5 — CID 146351333
1-N'-(4-fluorophenyl)-1-N-[4-[(E)-1-[5-methoxy-2-(methylideneamino)-4-[(2-methylpropan-2-yl)oxy]phenyl]prop-1-enoxy]phenyl]cyclopropane-1,1-dicarboxamide (PubChem CID 146351333) has the molecular formula C32H34FN3O5 and a molecular weight of 559.64 g/mol. Its IUPAC name is 1-N'-(4-fluorophenyl)-1-N-[4-[(E)-1-[5-methoxy-2-(methylideneamino)-4-[(2-methylpropan-2-yl)oxy]phenyl]prop-1-enoxy]phenyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(4-fluorophenyl)-1-N-[4-[(E)-1-[5-methoxy-2-(methylideneamino)-4-[(2-methylpropan-2-yl)oxy]phenyl]prop-1-enoxy]phenyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 146351333 |
| Molecular Formula | C32H34FN3O5 |
| Molecular Weight | 559.64 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | 1-N'-(4-fluorophenyl)-1-N-[4-[(E)-1-[5-methoxy-2-(methylideneamino)-4-[(2-methylpropan-2-yl)oxy]phenyl]prop-1-enoxy]phenyl]cyclopropane-1,1-dicarboxamide |
| SMILES | C=Nc1cc(OC(C)(C)C)c(OC)cc1/C(=C\C)Oc1ccc(NC(=O)C2(C(=O)Nc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C32H34FN3O5/c1-7-26(24-18-27(39-6)28(19-25(24)34-5)41-31(2,3)4)40-23-14-12-22(13-15-23)36-30(38)32(16-17-32)29(37)35-21-10-8-20(33)9-11-21/h7-15,18-19H,5,16-17H2,1-4,6H3,(H,35,37)(H,36,38)/b26-7+ |
| InChIKey | ADJIKLCJQUEBAS-IOXBOXJCSA-N |
| XLogP | 7.14 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.64 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|