About 6-(2-fluoro-4-methylcyclohexa-1,3-dien-1-yl)-1,2-dihydropyridine
6-(2-fluoro-4-methylcyclohexa-1,3-dien-1-yl)-1,2-dihydropyridine (PubChem CID 146351401) has the molecular formula C12H14FN
and a molecular weight of 191.25 g/mol. Its IUPAC name is 6-(2-fluoro-4-methylcyclohexa-1,3-dien-1-yl)-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 6-(2-fluoro-4-methylcyclohexa-1,3-dien-1-yl)-1,2-dihydropyridine |
| PubChem CID | 146351401 |
| Molecular Formula | C12H14FN |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 6-(2-fluoro-4-methylcyclohexa-1,3-dien-1-yl)-1,2-dihydropyridine |
| SMILES | CC1=CC(F)=C(C2=CC=CCN2)CC1 |
| InChI | InChI=1S/C12H14FN/c1-9-5-6-10(11(13)8-9)12-4-2-3-7-14-12/h2-4,8,14H,5-7H2,1H3 |
| InChIKey | HCXPMMQZGQYRPZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-(2-fluoro-4-methylcyclohexa-1,3-dien-1-yl)-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-fluoro-4-methylcyclohexa-1,3-dien-1-yl)-1,2-dihydropyridine?
The IUPAC name of 6-(2-fluoro-4-methylcyclohexa-1,3-dien-1-yl)-1,2-dihydropyridine (CID 146351401) is 6-(2-fluoro-4-methylcyclohexa-1,3-dien-1-yl)-1,2-dihydropyridine.
What is the SMILES notation for 6-(2-fluoro-4-methylcyclohexa-1,3-dien-1-yl)-1,2-dihydropyridine?
The canonical SMILES for 6-(2-fluoro-4-methylcyclohexa-1,3-dien-1-yl)-1,2-dihydropyridine is CC1=CC(F)=C(C2=CC=CCN2)CC1.
What is the InChIKey of 6-(2-fluoro-4-methylcyclohexa-1,3-dien-1-yl)-1,2-dihydropyridine?
The InChIKey is HCXPMMQZGQYRPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14FN/c1-9-5-6-10(11(13)8-9)12-4-2-3-7-14-12/h2-4,8,14H,5-7H2,1H3.
What are the key properties of 6-(2-fluoro-4-methylcyclohexa-1,3-dien-1-yl)-1,2-dihydropyridine?
6-(2-fluoro-4-methylcyclohexa-1,3-dien-1-yl)-1,2-dihydropyridine has a molecular weight of 191.25 g/mol, XLogP of 2.99, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-fluoro-4-methylcyclohexa-1,3-dien-1-yl)-1,2-dihydropyridine is sourced from PubChem (CID 146351401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).