C15H23NS — CID 146351729
3,4-dimethyl-2-[(3E,5Z)-8-methylnona-3,5,7-trien-4-yl]-2H-1,3-thiazole (PubChem CID 146351729) has the molecular formula C15H23NS and a molecular weight of 249.42 g/mol. Its IUPAC name is 3,4-dimethyl-2-[(3E,5Z)-8-methylnona-3,5,7-trien-4-yl]-2H-1,3-thiazole.
| Compound Name | 3,4-dimethyl-2-[(3E,5Z)-8-methylnona-3,5,7-trien-4-yl]-2H-1,3-thiazole |
|---|---|
| PubChem CID | 146351729 |
| Molecular Formula | C15H23NS |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 3,4-dimethyl-2-[(3E,5Z)-8-methylnona-3,5,7-trien-4-yl]-2H-1,3-thiazole |
| SMILES | CC/C=C(\C=C/C=C(C)C)C1SC=C(C)N1C |
| InChI | InChI=1S/C15H23NS/c1-6-8-14(10-7-9-12(2)3)15-16(5)13(4)11-17-15/h7-11,15H,6H2,1-5H3/b10-7-,14-8+ |
| InChIKey | HIPSXVBNVSPFNY-GBJAUHPPSA-N |
| XLogP | 4.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|