C22H25N7O11P2S2 — CID 146352087
2-amino-9-[17-(benzimidazol-1-yl)-3,9,18-trihydroxy-12-oxo-12-sulfanyl-3-sulfanylidene-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.3.0.06,10]octadecan-8-yl]-1H-purin-6-one (PubChem CID 146352087) has the molecular formula C22H25N7O11P2S2 and a molecular weight of 689.56 g/mol. Its IUPAC name is 2-amino-9-[17-(benzimidazol-1-yl)-3,9,18-trihydroxy-12-oxo-12-sulfanyl-3-sulfanylidene-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.3.0.06,10]octadecan-8-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[17-(benzimidazol-1-yl)-3,9,18-trihydroxy-12-oxo-12-sulfanyl-3-sulfanylidene-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.3.0.06,10]octadecan-8-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 146352087 |
| Molecular Formula | C22H25N7O11P2S2 |
| Molecular Weight | 689.56 g/mol |
| Exact Mass | 689.05 |
| IUPAC Name | 2-amino-9-[17-(benzimidazol-1-yl)-3,9,18-trihydroxy-12-oxo-12-sulfanyl-3-sulfanylidene-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.3.0.06,10]octadecan-8-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2C2OC3COP(O)(=S)OC4C(COP(=O)(S)OC3C2O)OC(n2cnc3ccccc32)C4O)c(=O)[nH]1 |
| InChI | InChI=1S/C22H25N7O11P2S2/c23-22-26-18-13(19(32)27-22)25-8-29(18)21-15(31)17-12(38-21)6-36-41(33,43)39-16-11(5-35-42(34,44)40-17)37-20(14(16)30)28-7-24-9-3-1-2-4-10(9)28/h1-4,7-8,11-12,14-17,20-21,30-31H,5-6H2,(H,33,43)(H,34,44)(H3,23,26,27,32) |
| InChIKey | SDSJKWVJWHILLD-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 240.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.56 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|