About (Z)-N-[(2R)-3,3-dimethylbutan-2-yl]-6,6-dimethylhept-3-ene-1-sulfonamide
(Z)-N-[(2R)-3,3-dimethylbutan-2-yl]-6,6-dimethylhept-3-ene-1-sulfonamide (PubChem CID 146352741) has the molecular formula C15H31NO2S
and a molecular weight of 289.48 g/mol. Its IUPAC name is (Z)-N-[(2R)-3,3-dimethylbutan-2-yl]-6,6-dimethylhept-3-ene-1-sulfonamide.
Molecular Properties
| Compound Name | (Z)-N-[(2R)-3,3-dimethylbutan-2-yl]-6,6-dimethylhept-3-ene-1-sulfonamide |
| PubChem CID | 146352741 |
| Molecular Formula | C15H31NO2S |
| Molecular Weight | 289.48 g/mol |
| Exact Mass | 289.21 |
| IUPAC Name | (Z)-N-[(2R)-3,3-dimethylbutan-2-yl]-6,6-dimethylhept-3-ene-1-sulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)CC/C=C\CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H31NO2S/c1-13(15(5,6)7)16-19(17,18)12-10-8-9-11-14(2,3)4/h8-9,13,16H,10-12H2,1-7H3/b9-8-/t13-/m1/s1 |
| InChIKey | MOYRXRUJBATLSA-LJTDUEICSA-N |
| XLogP | 3.72 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-[(2R)-3,3-dimethylbutan-2-yl]-6,6-dimethylhept-3-ene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-[(2R)-3,3-dimethylbutan-2-yl]-6,6-dimethylhept-3-ene-1-sulfonamide?
The IUPAC name of (Z)-N-[(2R)-3,3-dimethylbutan-2-yl]-6,6-dimethylhept-3-ene-1-sulfonamide (CID 146352741) is (Z)-N-[(2R)-3,3-dimethylbutan-2-yl]-6,6-dimethylhept-3-ene-1-sulfonamide.
What is the SMILES notation for (Z)-N-[(2R)-3,3-dimethylbutan-2-yl]-6,6-dimethylhept-3-ene-1-sulfonamide?
The canonical SMILES for (Z)-N-[(2R)-3,3-dimethylbutan-2-yl]-6,6-dimethylhept-3-ene-1-sulfonamide is C[C@@H](NS(=O)(=O)CC/C=C\CC(C)(C)C)C(C)(C)C.
What is the InChIKey of (Z)-N-[(2R)-3,3-dimethylbutan-2-yl]-6,6-dimethylhept-3-ene-1-sulfonamide?
The InChIKey is MOYRXRUJBATLSA-LJTDUEICSA-N. The full InChI is InChI=1S/C15H31NO2S/c1-13(15(5,6)7)16-19(17,18)12-10-8-9-11-14(2,3)4/h8-9,13,16H,10-12H2,1-7H3/b9-8-/t13-/m1/s1.
What are the key properties of (Z)-N-[(2R)-3,3-dimethylbutan-2-yl]-6,6-dimethylhept-3-ene-1-sulfonamide?
(Z)-N-[(2R)-3,3-dimethylbutan-2-yl]-6,6-dimethylhept-3-ene-1-sulfonamide has a molecular weight of 289.48 g/mol, XLogP of 3.72, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-[(2R)-3,3-dimethylbutan-2-yl]-6,6-dimethylhept-3-ene-1-sulfonamide is sourced from PubChem (CID 146352741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).