About N-[(3R)-2,2-dimethylpentan-3-yl]-4,4-dimethylpentane-1-sulfonamide
N-[(3R)-2,2-dimethylpentan-3-yl]-4,4-dimethylpentane-1-sulfonamide (PubChem CID 146352897) has the molecular formula C14H31NO2S
and a molecular weight of 277.47 g/mol. Its IUPAC name is N-[(3R)-2,2-dimethylpentan-3-yl]-4,4-dimethylpentane-1-sulfonamide.
Molecular Properties
| Compound Name | N-[(3R)-2,2-dimethylpentan-3-yl]-4,4-dimethylpentane-1-sulfonamide |
| PubChem CID | 146352897 |
| Molecular Formula | C14H31NO2S |
| Molecular Weight | 277.47 g/mol |
| Exact Mass | 277.21 |
| IUPAC Name | N-[(3R)-2,2-dimethylpentan-3-yl]-4,4-dimethylpentane-1-sulfonamide |
| SMILES | CC[C@@H](NS(=O)(=O)CCCC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H31NO2S/c1-8-12(14(5,6)7)15-18(16,17)11-9-10-13(2,3)4/h12,15H,8-11H2,1-7H3/t12-/m1/s1 |
| InChIKey | MTIOPDVXVGIICL-GFCCVEGCSA-N |
| XLogP | 3.56 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(3R)-2,2-dimethylpentan-3-yl]-4,4-dimethylpentane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R)-2,2-dimethylpentan-3-yl]-4,4-dimethylpentane-1-sulfonamide?
The IUPAC name of N-[(3R)-2,2-dimethylpentan-3-yl]-4,4-dimethylpentane-1-sulfonamide (CID 146352897) is N-[(3R)-2,2-dimethylpentan-3-yl]-4,4-dimethylpentane-1-sulfonamide.
What is the SMILES notation for N-[(3R)-2,2-dimethylpentan-3-yl]-4,4-dimethylpentane-1-sulfonamide?
The canonical SMILES for N-[(3R)-2,2-dimethylpentan-3-yl]-4,4-dimethylpentane-1-sulfonamide is CC[C@@H](NS(=O)(=O)CCCC(C)(C)C)C(C)(C)C.
What is the InChIKey of N-[(3R)-2,2-dimethylpentan-3-yl]-4,4-dimethylpentane-1-sulfonamide?
The InChIKey is MTIOPDVXVGIICL-GFCCVEGCSA-N. The full InChI is InChI=1S/C14H31NO2S/c1-8-12(14(5,6)7)15-18(16,17)11-9-10-13(2,3)4/h12,15H,8-11H2,1-7H3/t12-/m1/s1.
What are the key properties of N-[(3R)-2,2-dimethylpentan-3-yl]-4,4-dimethylpentane-1-sulfonamide?
N-[(3R)-2,2-dimethylpentan-3-yl]-4,4-dimethylpentane-1-sulfonamide has a molecular weight of 277.47 g/mol, XLogP of 3.56, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R)-2,2-dimethylpentan-3-yl]-4,4-dimethylpentane-1-sulfonamide is sourced from PubChem (CID 146352897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).