C15H31NO2S — CID 146352968
N-[(E,2S)-8,8-dimethylnon-3-en-2-yl]-2-methylpropane-2-sulfonamide (PubChem CID 146352968) has the molecular formula C15H31NO2S and a molecular weight of 289.48 g/mol. Its IUPAC name is N-[(E,2S)-8,8-dimethylnon-3-en-2-yl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[(E,2S)-8,8-dimethylnon-3-en-2-yl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 146352968 |
| Molecular Formula | C15H31NO2S |
| Molecular Weight | 289.48 g/mol |
| Exact Mass | 289.21 |
| IUPAC Name | N-[(E,2S)-8,8-dimethylnon-3-en-2-yl]-2-methylpropane-2-sulfonamide |
| SMILES | C[C@@H](/C=C/CCCC(C)(C)C)NS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C15H31NO2S/c1-13(16-19(17,18)15(5,6)7)11-9-8-10-12-14(2,3)4/h9,11,13,16H,8,10,12H2,1-7H3/b11-9+/t13-/m0/s1 |
| InChIKey | PYWOONQOULZEQK-STRFDMGBSA-N |
| XLogP | 3.87 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|