About N-[[(2R)-3,3-dimethylbutan-2-yl]sulfamoyl]-5,5-dimethylhexan-1-amine
N-[[(2R)-3,3-dimethylbutan-2-yl]sulfamoyl]-5,5-dimethylhexan-1-amine (PubChem CID 146352975) has the molecular formula C14H32N2O2S
and a molecular weight of 292.49 g/mol. Its IUPAC name is N-[[(2R)-3,3-dimethylbutan-2-yl]sulfamoyl]-5,5-dimethylhexan-1-amine.
Molecular Properties
| Compound Name | N-[[(2R)-3,3-dimethylbutan-2-yl]sulfamoyl]-5,5-dimethylhexan-1-amine |
| PubChem CID | 146352975 |
| Molecular Formula | C14H32N2O2S |
| Molecular Weight | 292.49 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | N-[[(2R)-3,3-dimethylbutan-2-yl]sulfamoyl]-5,5-dimethylhexan-1-amine |
| SMILES | C[C@@H](NS(=O)(=O)NCCCCC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H32N2O2S/c1-12(14(5,6)7)16-19(17,18)15-11-9-8-10-13(2,3)4/h12,15-16H,8-11H2,1-7H3/t12-/m1/s1 |
| InChIKey | IKCDYSCKZLZXJS-GFCCVEGCSA-N |
| XLogP | 3.06 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[[(2R)-3,3-dimethylbutan-2-yl]sulfamoyl]-5,5-dimethylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(2R)-3,3-dimethylbutan-2-yl]sulfamoyl]-5,5-dimethylhexan-1-amine?
The IUPAC name of N-[[(2R)-3,3-dimethylbutan-2-yl]sulfamoyl]-5,5-dimethylhexan-1-amine (CID 146352975) is N-[[(2R)-3,3-dimethylbutan-2-yl]sulfamoyl]-5,5-dimethylhexan-1-amine.
What is the SMILES notation for N-[[(2R)-3,3-dimethylbutan-2-yl]sulfamoyl]-5,5-dimethylhexan-1-amine?
The canonical SMILES for N-[[(2R)-3,3-dimethylbutan-2-yl]sulfamoyl]-5,5-dimethylhexan-1-amine is C[C@@H](NS(=O)(=O)NCCCCC(C)(C)C)C(C)(C)C.
What is the InChIKey of N-[[(2R)-3,3-dimethylbutan-2-yl]sulfamoyl]-5,5-dimethylhexan-1-amine?
The InChIKey is IKCDYSCKZLZXJS-GFCCVEGCSA-N. The full InChI is InChI=1S/C14H32N2O2S/c1-12(14(5,6)7)16-19(17,18)15-11-9-8-10-13(2,3)4/h12,15-16H,8-11H2,1-7H3/t12-/m1/s1.
What are the key properties of N-[[(2R)-3,3-dimethylbutan-2-yl]sulfamoyl]-5,5-dimethylhexan-1-amine?
N-[[(2R)-3,3-dimethylbutan-2-yl]sulfamoyl]-5,5-dimethylhexan-1-amine has a molecular weight of 292.49 g/mol, XLogP of 3.06, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(2R)-3,3-dimethylbutan-2-yl]sulfamoyl]-5,5-dimethylhexan-1-amine is sourced from PubChem (CID 146352975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).