About (Z)-N-tert-butyl-6,6-dimethylhept-3-ene-1-sulfonamide
(Z)-N-tert-butyl-6,6-dimethylhept-3-ene-1-sulfonamide (PubChem CID 146353096) has the molecular formula C13H27NO2S
and a molecular weight of 261.43 g/mol. Its IUPAC name is (Z)-N-tert-butyl-6,6-dimethylhept-3-ene-1-sulfonamide.
Molecular Properties
| Compound Name | (Z)-N-tert-butyl-6,6-dimethylhept-3-ene-1-sulfonamide |
| PubChem CID | 146353096 |
| Molecular Formula | C13H27NO2S |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | (Z)-N-tert-butyl-6,6-dimethylhept-3-ene-1-sulfonamide |
| SMILES | CC(C)(C)C/C=C\CCS(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C13H27NO2S/c1-12(2,3)10-8-7-9-11-17(15,16)14-13(4,5)6/h7-8,14H,9-11H2,1-6H3/b8-7- |
| InChIKey | HCRGLVCDFBZLHU-FPLPWBNLSA-N |
| XLogP | 3.09 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-tert-butyl-6,6-dimethylhept-3-ene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-tert-butyl-6,6-dimethylhept-3-ene-1-sulfonamide?
The IUPAC name of (Z)-N-tert-butyl-6,6-dimethylhept-3-ene-1-sulfonamide (CID 146353096) is (Z)-N-tert-butyl-6,6-dimethylhept-3-ene-1-sulfonamide.
What is the SMILES notation for (Z)-N-tert-butyl-6,6-dimethylhept-3-ene-1-sulfonamide?
The canonical SMILES for (Z)-N-tert-butyl-6,6-dimethylhept-3-ene-1-sulfonamide is CC(C)(C)C/C=C\CCS(=O)(=O)NC(C)(C)C.
What is the InChIKey of (Z)-N-tert-butyl-6,6-dimethylhept-3-ene-1-sulfonamide?
The InChIKey is HCRGLVCDFBZLHU-FPLPWBNLSA-N. The full InChI is InChI=1S/C13H27NO2S/c1-12(2,3)10-8-7-9-11-17(15,16)14-13(4,5)6/h7-8,14H,9-11H2,1-6H3/b8-7-.
What are the key properties of (Z)-N-tert-butyl-6,6-dimethylhept-3-ene-1-sulfonamide?
(Z)-N-tert-butyl-6,6-dimethylhept-3-ene-1-sulfonamide has a molecular weight of 261.43 g/mol, XLogP of 3.09, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-tert-butyl-6,6-dimethylhept-3-ene-1-sulfonamide is sourced from PubChem (CID 146353096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).