C14H29N3 — CID 146353278
N-amino-N'-[(Z)-5,5-dimethylhex-2-en-3-yl]-3,3-dimethylbutanimidamide (PubChem CID 146353278) has the molecular formula C14H29N3 and a molecular weight of 239.41 g/mol. Its IUPAC name is N-amino-N'-[(Z)-5,5-dimethylhex-2-en-3-yl]-3,3-dimethylbutanimidamide.
| Compound Name | N-amino-N'-[(Z)-5,5-dimethylhex-2-en-3-yl]-3,3-dimethylbutanimidamide |
|---|---|
| PubChem CID | 146353278 |
| Molecular Formula | C14H29N3 |
| Molecular Weight | 239.41 g/mol |
| Exact Mass | 239.24 |
| IUPAC Name | N-amino-N'-[(Z)-5,5-dimethylhex-2-en-3-yl]-3,3-dimethylbutanimidamide |
| SMILES | C/C=C(CC(C)(C)C)\N=C(/CC(C)(C)C)NN |
| InChI | InChI=1S/C14H29N3/c1-8-11(9-13(2,3)4)16-12(17-15)10-14(5,6)7/h8H,9-10,15H2,1-7H3,(H,16,17)/b11-8- |
| InChIKey | OCUXWCCZWDQHFS-FLIBITNWSA-N |
| XLogP | 3.62 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|