C12H22N2OS — CID 146353391
3-[5-(2,2-dimethylpropyl)-1,3,4-oxadiazol-2-yl]-2,2-dimethylpropane-1-thiol (PubChem CID 146353391) has the molecular formula C12H22N2OS and a molecular weight of 242.39 g/mol. Its IUPAC name is 3-[5-(2,2-dimethylpropyl)-1,3,4-oxadiazol-2-yl]-2,2-dimethylpropane-1-thiol.
| Compound Name | 3-[5-(2,2-dimethylpropyl)-1,3,4-oxadiazol-2-yl]-2,2-dimethylpropane-1-thiol |
|---|---|
| PubChem CID | 146353391 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 3-[5-(2,2-dimethylpropyl)-1,3,4-oxadiazol-2-yl]-2,2-dimethylpropane-1-thiol |
| SMILES | CC(C)(C)Cc1nnc(CC(C)(C)CS)o1 |
| InChI | InChI=1S/C12H22N2OS/c1-11(2,3)6-9-13-14-10(15-9)7-12(4,5)8-16/h16H,6-8H2,1-5H3 |
| InChIKey | ZCEWCEOOXCBZFV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 38.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|