C38H20N2O2 — CID 146353959
7-[2-(3-cyanophenyl)-3-dibenzofuran-3-ylphenyl]dibenzofuran-2-carbonitrile (PubChem CID 146353959) has the molecular formula C38H20N2O2 and a molecular weight of 536.59 g/mol. Its IUPAC name is 7-[2-(3-cyanophenyl)-3-dibenzofuran-3-ylphenyl]dibenzofuran-2-carbonitrile.
| Compound Name | 7-[2-(3-cyanophenyl)-3-dibenzofuran-3-ylphenyl]dibenzofuran-2-carbonitrile |
|---|---|
| PubChem CID | 146353959 |
| Molecular Formula | C38H20N2O2 |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.15 |
| IUPAC Name | 7-[2-(3-cyanophenyl)-3-dibenzofuran-3-ylphenyl]dibenzofuran-2-carbonitrile |
| SMILES | N#Cc1cccc(-c2c(-c3ccc4c(c3)oc3ccccc34)cccc2-c2ccc3c(c2)oc2ccc(C#N)cc23)c1 |
| InChI | InChI=1S/C38H20N2O2/c39-21-23-5-3-6-27(17-23)38-28(25-12-14-31-30-7-1-2-10-34(30)41-36(31)19-25)8-4-9-29(38)26-13-15-32-33-18-24(22-40)11-16-35(33)42-37(32)20-26/h1-20H |
| InChIKey | JAYKXDNOYMONPX-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 73.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |