C39H19N3O2 — CID 146354530
4-[4-cyano-3,5-di(dibenzofuran-2-yl)phenyl]benzene-1,3-dicarbonitrile (PubChem CID 146354530) has the molecular formula C39H19N3O2 and a molecular weight of 561.60 g/mol. Its IUPAC name is 4-[4-cyano-3,5-di(dibenzofuran-2-yl)phenyl]benzene-1,3-dicarbonitrile.
| Compound Name | 4-[4-cyano-3,5-di(dibenzofuran-2-yl)phenyl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 146354530 |
| Molecular Formula | C39H19N3O2 |
| Molecular Weight | 561.60 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | 4-[4-cyano-3,5-di(dibenzofuran-2-yl)phenyl]benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1ccc(-c2cc(-c3ccc4oc5ccccc5c4c3)c(C#N)c(-c3ccc4oc5ccccc5c4c3)c2)c(C#N)c1 |
| InChI | InChI=1S/C39H19N3O2/c40-20-23-9-12-28(27(15-23)21-41)26-18-31(24-10-13-38-33(16-24)29-5-1-3-7-36(29)43-38)35(22-42)32(19-26)25-11-14-39-34(17-25)30-6-2-4-8-37(30)44-39/h1-19H |
| InChIKey | STTTUANNTCTHRK-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 97.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.60 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |