C39H19N3S2 — CID 146355370
2-[4-cyano-3,5-di(dibenzothiophen-2-yl)phenyl]benzene-1,3-dicarbonitrile (PubChem CID 146355370) has the molecular formula C39H19N3S2 and a molecular weight of 593.74 g/mol. Its IUPAC name is 2-[4-cyano-3,5-di(dibenzothiophen-2-yl)phenyl]benzene-1,3-dicarbonitrile.
| Compound Name | 2-[4-cyano-3,5-di(dibenzothiophen-2-yl)phenyl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 146355370 |
| Molecular Formula | C39H19N3S2 |
| Molecular Weight | 593.74 g/mol |
| Exact Mass | 593.10 |
| IUPAC Name | 2-[4-cyano-3,5-di(dibenzothiophen-2-yl)phenyl]benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cccc(C#N)c1-c1cc(-c2ccc3sc4ccccc4c3c2)c(C#N)c(-c2ccc3sc4ccccc4c3c2)c1 |
| InChI | InChI=1S/C39H19N3S2/c40-20-25-6-5-7-26(21-41)39(25)27-18-30(23-12-14-37-32(16-23)28-8-1-3-10-35(28)43-37)34(22-42)31(19-27)24-13-15-38-33(17-24)29-9-2-4-11-36(29)44-38/h1-19H |
| InChIKey | XBPAXKXJXKVIBO-UHFFFAOYSA-N |
| XLogP | 11.04 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.74 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |