C20H28O3 — CID 14635543
(4aS,7aR,10aS,11aR,11bS)-4,4,7a,11b-tetramethyl-2,4a,5,6,10,10a,11,11a-octahydro-1H-naphtho[1,2-f][2]benzofuran-3,8-dione (PubChem CID 14635543) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (4aS,7aR,10aS,11aR,11bS)-4,4,7a,11b-tetramethyl-2,4a,5,6,10,10a,11,11a-octahydro-1H-naphtho[1,2-f][2]benzofuran-3,8-dione.
| Compound Name | (4aS,7aR,10aS,11aR,11bS)-4,4,7a,11b-tetramethyl-2,4a,5,6,10,10a,11,11a-octahydro-1H-naphtho[1,2-f][2]benzofuran-3,8-dione |
|---|---|
| PubChem CID | 14635543 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (4aS,7aR,10aS,11aR,11bS)-4,4,7a,11b-tetramethyl-2,4a,5,6,10,10a,11,11a-octahydro-1H-naphtho[1,2-f][2]benzofuran-3,8-dione |
| SMILES | CC1(C)C(=O)CC[C@@]2(C)[C@@H]3C[C@@H]4COC(=O)[C@]4(C)C=C3CC[C@H]12 |
| InChI | InChI=1S/C20H28O3/c1-18(2)15-6-5-12-10-20(4)13(11-23-17(20)22)9-14(12)19(15,3)8-7-16(18)21/h10,13-15H,5-9,11H2,1-4H3/t13-,14-,15-,19+,20-/m1/s1 |
| InChIKey | SAWFXJMPLDQMND-IJONRSMUSA-N |
| XLogP | 3.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|