C11H23N3O6P2 — CID 146355784
(2S)-4-[amino-[[(2S,6S)-6-methylmorpholin-2-yl]methoxy]phosphoryl]-2-(phosphorosooxymethyl)morpholine (PubChem CID 146355784) has the molecular formula C11H23N3O6P2 and a molecular weight of 355.27 g/mol. Its IUPAC name is (2S)-4-[amino-[[(2S,6S)-6-methylmorpholin-2-yl]methoxy]phosphoryl]-2-(phosphorosooxymethyl)morpholine.
| Compound Name | (2S)-4-[amino-[[(2S,6S)-6-methylmorpholin-2-yl]methoxy]phosphoryl]-2-(phosphorosooxymethyl)morpholine |
|---|---|
| PubChem CID | 146355784 |
| Molecular Formula | C11H23N3O6P2 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | (2S)-4-[amino-[[(2S,6S)-6-methylmorpholin-2-yl]methoxy]phosphoryl]-2-(phosphorosooxymethyl)morpholine |
| SMILES | C[C@H]1CNC[C@@H](COP(N)(=O)N2CCO[C@H](COP=O)C2)O1 |
| InChI | InChI=1S/C11H23N3O6P2/c1-9-4-13-5-10(20-9)8-19-22(12,16)14-2-3-17-11(6-14)7-18-21-15/h9-11,13H,2-8H2,1H3,(H2,12,16)/t9-,10-,11-,22?/m0/s1 |
| InChIKey | CCSFNRISVPRZKW-GMWNMMDESA-N |
| XLogP | 0.37 |
| TPSA | 112.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|