About 4-nitro-N,N-di(propan-2-yl)benzenesulfinamide
4-nitro-N,N-di(propan-2-yl)benzenesulfinamide (PubChem CID 146355841) has the molecular formula C12H18N2O3S
and a molecular weight of 270.35 g/mol. Its IUPAC name is 4-nitro-N,N-di(propan-2-yl)benzenesulfinamide.
Molecular Properties
| Compound Name | 4-nitro-N,N-di(propan-2-yl)benzenesulfinamide |
| PubChem CID | 146355841 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 4-nitro-N,N-di(propan-2-yl)benzenesulfinamide |
| SMILES | CC(C)N(C(C)C)S(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H18N2O3S/c1-9(2)13(10(3)4)18(17)12-7-5-11(6-8-12)14(15)16/h5-10H,1-4H3 |
| InChIKey | JOUVKSGLGJMOHK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-N,N-di(propan-2-yl)benzenesulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-N,N-di(propan-2-yl)benzenesulfinamide?
The IUPAC name of 4-nitro-N,N-di(propan-2-yl)benzenesulfinamide (CID 146355841) is 4-nitro-N,N-di(propan-2-yl)benzenesulfinamide.
What is the SMILES notation for 4-nitro-N,N-di(propan-2-yl)benzenesulfinamide?
The canonical SMILES for 4-nitro-N,N-di(propan-2-yl)benzenesulfinamide is CC(C)N(C(C)C)S(=O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 4-nitro-N,N-di(propan-2-yl)benzenesulfinamide?
The InChIKey is JOUVKSGLGJMOHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O3S/c1-9(2)13(10(3)4)18(17)12-7-5-11(6-8-12)14(15)16/h5-10H,1-4H3.
What are the key properties of 4-nitro-N,N-di(propan-2-yl)benzenesulfinamide?
4-nitro-N,N-di(propan-2-yl)benzenesulfinamide has a molecular weight of 270.35 g/mol, XLogP of 2.74, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-N,N-di(propan-2-yl)benzenesulfinamide is sourced from PubChem (CID 146355841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).