C30H26F4N2O4 — CID 146355844
6-pentan-3-yl-13-(2,3,5,6-tetrafluoro-4-pentan-3-ylphenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 146355844) has the molecular formula C30H26F4N2O4 and a molecular weight of 554.54 g/mol. Its IUPAC name is 6-pentan-3-yl-13-(2,3,5,6-tetrafluoro-4-pentan-3-ylphenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6-pentan-3-yl-13-(2,3,5,6-tetrafluoro-4-pentan-3-ylphenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 146355844 |
| Molecular Formula | C30H26F4N2O4 |
| Molecular Weight | 554.54 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | 6-pentan-3-yl-13-(2,3,5,6-tetrafluoro-4-pentan-3-ylphenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | CCC(CC)c1c(F)c(F)c(N2C(=O)c3ccc4c5c(ccc(c35)C2=O)C(=O)N(C(CC)CC)C4=O)c(F)c1F |
| InChI | InChI=1S/C30H26F4N2O4/c1-5-13(6-2)19-22(31)24(33)26(25(34)23(19)32)36-29(39)17-11-9-15-20-16(10-12-18(21(17)20)30(36)40)28(38)35(27(15)37)14(7-3)8-4/h9-14H,5-8H2,1-4H3 |
| InChIKey | NTRORMWDYAXPPE-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.54 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|