C22H9Cl7N6O3 — CID 146356381
3-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)quinazolin-4-one;1,2,3,4,5-pentachloro-6-nitrobenzene (PubChem CID 146356381) has the molecular formula C22H9Cl7N6O3 and a molecular weight of 653.52 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)quinazolin-4-one;1,2,3,4,5-pentachloro-6-nitrobenzene.
| Compound Name | 3-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)quinazolin-4-one;1,2,3,4,5-pentachloro-6-nitrobenzene |
|---|---|
| PubChem CID | 146356381 |
| Molecular Formula | C22H9Cl7N6O3 |
| Molecular Weight | 653.52 g/mol |
| Exact Mass | 649.86 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)quinazolin-4-one;1,2,3,4,5-pentachloro-6-nitrobenzene |
| SMILES | O=[N+]([O-])c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl.O=c1c2ccccc2nc(-n2cncn2)n1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H9Cl2N5O.C6Cl5NO2/c17-10-5-6-14(12(18)7-10)23-15(24)11-3-1-2-4-13(11)21-16(23)22-9-19-8-20-22;7-1-2(8)4(10)6(12(13)14)5(11)3(1)9/h1-9H; |
| InChIKey | GLJFJRJPLIJORQ-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 108.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.52 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|