C28H31FNO7P — CID 146357057
methyl (2S,4aR,6aR,7R,9S,10aS,10bR)-9-[(4-fluorophenyl)carbamoyloxy]-6a,10b-dimethyl-4,10-dioxo-2-(1H-phosphol-3-yl)-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate (PubChem CID 146357057) has the molecular formula C28H31FNO7P and a molecular weight of 543.53 g/mol. Its IUPAC name is methyl (2S,4aR,6aR,7R,9S,10aS,10bR)-9-[(4-fluorophenyl)carbamoyloxy]-6a,10b-dimethyl-4,10-dioxo-2-(1H-phosphol-3-yl)-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate.
| Compound Name | methyl (2S,4aR,6aR,7R,9S,10aS,10bR)-9-[(4-fluorophenyl)carbamoyloxy]-6a,10b-dimethyl-4,10-dioxo-2-(1H-phosphol-3-yl)-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate |
|---|---|
| PubChem CID | 146357057 |
| Molecular Formula | C28H31FNO7P |
| Molecular Weight | 543.53 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | methyl (2S,4aR,6aR,7R,9S,10aS,10bR)-9-[(4-fluorophenyl)carbamoyloxy]-6a,10b-dimethyl-4,10-dioxo-2-(1H-phosphol-3-yl)-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](OC(=O)Nc2ccc(F)cc2)C(=O)[C@H]2[C@@]1(C)CC[C@H]1C(=O)O[C@H](c3cc[pH]c3)C[C@]21C |
| InChI | InChI=1S/C28H31FNO7P/c1-27-10-8-18-25(33)36-21(15-9-11-38-14-15)13-28(18,2)23(27)22(31)20(12-19(27)24(32)35-3)37-26(34)30-17-6-4-16(29)5-7-17/h4-7,9,11,14,18-21,23,38H,8,10,12-13H2,1-3H3,(H,30,34)/t18-,19-,20-,21-,23-,27-,28-/m0/s1 |
| InChIKey | MQLQJXZFIKUSHL-XAGHGKQISA-N |
| XLogP | 5.26 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|