About [[6-(2-fluoropropan-2-yl)-1-hydroxypyridin-1-ium-3-yl]methyl-methyl-oxo-λ6-sulfanylidene]urea
[[6-(2-fluoropropan-2-yl)-1-hydroxypyridin-1-ium-3-yl]methyl-methyl-oxo-λ6-sulfanylidene]urea (PubChem CID 146357802) has the molecular formula C11H17FN3O3S+
and a molecular weight of 290.34 g/mol. Its IUPAC name is [[6-(2-fluoropropan-2-yl)-1-hydroxypyridin-1-ium-3-yl]methyl-methyl-oxo-λ6-sulfanylidene]urea.
Molecular Properties
| Compound Name | [[6-(2-fluoropropan-2-yl)-1-hydroxypyridin-1-ium-3-yl]methyl-methyl-oxo-λ6-sulfanylidene]urea |
| PubChem CID | 146357802 |
| Molecular Formula | C11H17FN3O3S+ |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | [[6-(2-fluoropropan-2-yl)-1-hydroxypyridin-1-ium-3-yl]methyl-methyl-oxo-λ6-sulfanylidene]urea |
| SMILES | CC(C)(F)c1ccc(CS(C)(=O)=NC(N)=O)c[n+]1O |
| InChI | InChI=1S/C11H16FN3O3S/c1-11(2,12)9-5-4-8(6-15(9)17)7-19(3,18)14-10(13)16/h4-6H,7H2,1-3H3,(H2-,13,16,17)/p+1 |
| InChIKey | UAPXGFZRZWRGNY-UHFFFAOYSA-O |
| XLogP | 1.09 |
| TPSA | 96.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [[6-(2-fluoropropan-2-yl)-1-hydroxypyridin-1-ium-3-yl]methyl-methyl-oxo-λ6-sulfanylidene]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[6-(2-fluoropropan-2-yl)-1-hydroxypyridin-1-ium-3-yl]methyl-methyl-oxo-λ6-sulfanylidene]urea?
The IUPAC name of [[6-(2-fluoropropan-2-yl)-1-hydroxypyridin-1-ium-3-yl]methyl-methyl-oxo-λ6-sulfanylidene]urea (CID 146357802) is [[6-(2-fluoropropan-2-yl)-1-hydroxypyridin-1-ium-3-yl]methyl-methyl-oxo-λ6-sulfanylidene]urea.
What is the SMILES notation for [[6-(2-fluoropropan-2-yl)-1-hydroxypyridin-1-ium-3-yl]methyl-methyl-oxo-λ6-sulfanylidene]urea?
The canonical SMILES for [[6-(2-fluoropropan-2-yl)-1-hydroxypyridin-1-ium-3-yl]methyl-methyl-oxo-λ6-sulfanylidene]urea is CC(C)(F)c1ccc(CS(C)(=O)=NC(N)=O)c[n+]1O.
What is the InChIKey of [[6-(2-fluoropropan-2-yl)-1-hydroxypyridin-1-ium-3-yl]methyl-methyl-oxo-λ6-sulfanylidene]urea?
The InChIKey is UAPXGFZRZWRGNY-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H16FN3O3S/c1-11(2,12)9-5-4-8(6-15(9)17)7-19(3,18)14-10(13)16/h4-6H,7H2,1-3H3,(H2-,13,16,17)/p+1.
What are the key properties of [[6-(2-fluoropropan-2-yl)-1-hydroxypyridin-1-ium-3-yl]methyl-methyl-oxo-λ6-sulfanylidene]urea?
[[6-(2-fluoropropan-2-yl)-1-hydroxypyridin-1-ium-3-yl]methyl-methyl-oxo-λ6-sulfanylidene]urea has a molecular weight of 290.34 g/mol, XLogP of 1.09, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [[6-(2-fluoropropan-2-yl)-1-hydroxypyridin-1-ium-3-yl]methyl-methyl-oxo-λ6-sulfanylidene]urea is sourced from PubChem (CID 146357802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).