C10H11N3O2 — CID 146358347
N-[[5-[(1E,3Z)-hexa-1,3,5-trienyl]-1,2,4-oxadiazol-3-yl]methyl]formamide (PubChem CID 146358347) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is N-[[5-[(1E,3Z)-hexa-1,3,5-trienyl]-1,2,4-oxadiazol-3-yl]methyl]formamide.
| Compound Name | N-[[5-[(1E,3Z)-hexa-1,3,5-trienyl]-1,2,4-oxadiazol-3-yl]methyl]formamide |
|---|---|
| PubChem CID | 146358347 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | N-[[5-[(1E,3Z)-hexa-1,3,5-trienyl]-1,2,4-oxadiazol-3-yl]methyl]formamide |
| SMILES | C=C/C=C\C=C\c1nc(CNC=O)no1 |
| InChI | InChI=1S/C10H11N3O2/c1-2-3-4-5-6-10-12-9(13-15-10)7-11-8-14/h2-6,8H,1,7H2,(H,11,14)/b4-3-,6-5+ |
| InChIKey | RBSUFPQTCRBOAI-DNVGVPOPSA-N |
| XLogP | 1.07 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|