C29H50N2OS — CID 146358866
N-[(4S)-4-methyl-2-[[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]amino]hex-1-en-3-yl]acetamide (PubChem CID 146358866) has the molecular formula C29H50N2OS and a molecular weight of 474.80 g/mol. Its IUPAC name is N-[(4S)-4-methyl-2-[[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]amino]hex-1-en-3-yl]acetamide.
| Compound Name | N-[(4S)-4-methyl-2-[[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]amino]hex-1-en-3-yl]acetamide |
|---|---|
| PubChem CID | 146358866 |
| Molecular Formula | C29H50N2OS |
| Molecular Weight | 474.80 g/mol |
| Exact Mass | 474.36 |
| IUPAC Name | N-[(4S)-4-methyl-2-[[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]amino]hex-1-en-3-yl]acetamide |
| SMILES | C=C(C)C(CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)NC(=C)C(NC(C)=O)[C@@H](C)CC |
| InChI | InChI=1S/C29H50N2OS/c1-11-25(8)29(31-27(10)32)26(9)30-28(22(4)5)20-33-19-18-24(7)17-13-16-23(6)15-12-14-21(2)3/h14,16,18,25,28-30H,4,9,11-13,15,17,19-20H2,1-3,5-8,10H3,(H,31,32)/b23-16+,24-18+/t25-,28?,29?/m0/s1 |
| InChIKey | GZFVOZHOXQXUID-SJKHTLPKSA-N |
| XLogP | 7.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.80 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|