C30H57NS — CID 146358934
5-methyl-N-[1-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropan-2-yl]hexa-1,5-dien-2-amine (PubChem CID 146358934) has the molecular formula C30H57NS and a molecular weight of 463.86 g/mol. Its IUPAC name is 5-methyl-N-[1-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropan-2-yl]hexa-1,5-dien-2-amine.
| Compound Name | 5-methyl-N-[1-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropan-2-yl]hexa-1,5-dien-2-amine |
|---|---|
| PubChem CID | 146358934 |
| Molecular Formula | C30H57NS |
| Molecular Weight | 463.86 g/mol |
| Exact Mass | 463.42 |
| IUPAC Name | 5-methyl-N-[1-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropan-2-yl]hexa-1,5-dien-2-amine |
| SMILES | C=C(C)CCC(=C)NC(C)CSC/C=C(\C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C30H57NS/c1-24(2)13-10-14-26(5)15-11-16-27(6)17-12-18-28(7)21-22-32-23-30(9)31-29(8)20-19-25(3)4/h21,24,26-27,30-31H,3,8,10-20,22-23H2,1-2,4-7,9H3/b28-21+ |
| InChIKey | IGFJNSHHMXZDGJ-SGWCAAJKSA-N |
| XLogP | 9.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.86 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|