C26H43NS — CID 146358981
3-methyl-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]hexa-1,5-dien-2-amine (PubChem CID 146358981) has the molecular formula C26H43NS and a molecular weight of 401.70 g/mol. Its IUPAC name is 3-methyl-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]hexa-1,5-dien-2-amine.
| Compound Name | 3-methyl-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]hexa-1,5-dien-2-amine |
|---|---|
| PubChem CID | 146358981 |
| Molecular Formula | C26H43NS |
| Molecular Weight | 401.70 g/mol |
| Exact Mass | 401.31 |
| IUPAC Name | 3-methyl-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]hexa-1,5-dien-2-amine |
| SMILES | C=CCC(C)C(=C)NC(C=C)CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C26H43NS/c1-9-13-24(7)25(8)27-26(10-2)20-28-19-18-23(6)17-12-16-22(5)15-11-14-21(3)4/h9-10,14,16,18,24,26-27H,1-2,8,11-13,15,17,19-20H2,3-7H3/b22-16+,23-18+ |
| InChIKey | YHIGMNDXOMYFLN-NERIYXGDSA-N |
| XLogP | 8.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.70 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|