C26H47N3S — CID 146359008
3-N-methyl-6-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]hepta-1,6-diene-2,3,6-triamine (PubChem CID 146359008) has the molecular formula C26H47N3S and a molecular weight of 433.75 g/mol. Its IUPAC name is 3-N-methyl-6-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]hepta-1,6-diene-2,3,6-triamine.
| Compound Name | 3-N-methyl-6-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]hepta-1,6-diene-2,3,6-triamine |
|---|---|
| PubChem CID | 146359008 |
| Molecular Formula | C26H47N3S |
| Molecular Weight | 433.75 g/mol |
| Exact Mass | 433.35 |
| IUPAC Name | 3-N-methyl-6-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]hepta-1,6-diene-2,3,6-triamine |
| SMILES | C=C(CCC(NC)C(=C)N)NC(C)CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C26H47N3S/c1-20(2)11-9-12-21(3)13-10-14-22(4)17-18-30-19-24(6)29-23(5)15-16-26(28-8)25(7)27/h11,13,17,24,26,28-29H,5,7,9-10,12,14-16,18-19,27H2,1-4,6,8H3/b21-13+,22-17+ |
| InChIKey | QMUSFYGVIKDFLZ-BRAPJGFWSA-N |
| XLogP | 6.47 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.75 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|