C28H48N2S — CID 146359030
4-N-[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]-1-N-prop-1-en-2-ylpent-4-ene-1,4-diamine (PubChem CID 146359030) has the molecular formula C28H48N2S and a molecular weight of 444.77 g/mol. Its IUPAC name is 4-N-[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]-1-N-prop-1-en-2-ylpent-4-ene-1,4-diamine.
| Compound Name | 4-N-[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]-1-N-prop-1-en-2-ylpent-4-ene-1,4-diamine |
|---|---|
| PubChem CID | 146359030 |
| Molecular Formula | C28H48N2S |
| Molecular Weight | 444.77 g/mol |
| Exact Mass | 444.35 |
| IUPAC Name | 4-N-[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]-1-N-prop-1-en-2-ylpent-4-ene-1,4-diamine |
| SMILES | C=C(C)NCCCC(=C)NC(CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=C)C |
| InChI | InChI=1S/C28H48N2S/c1-22(2)13-10-14-25(7)15-11-16-26(8)18-20-31-21-28(23(3)4)30-27(9)17-12-19-29-24(5)6/h13,15,18,28-30H,3,5,9-12,14,16-17,19-21H2,1-2,4,6-8H3/b25-15+,26-18+ |
| InChIKey | SIMNYSNGDPRNBS-CQKXQQKSSA-N |
| XLogP | 8.09 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.77 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|