C17H34N2O — CID 146359257
(2S)-4-[[(5-amino-3,3,5-trimethylhex-1-en-2-yl)amino]methyl]-2-methylhex-5-en-1-ol (PubChem CID 146359257) has the molecular formula C17H34N2O and a molecular weight of 282.47 g/mol. Its IUPAC name is (2S)-4-[[(5-amino-3,3,5-trimethylhex-1-en-2-yl)amino]methyl]-2-methylhex-5-en-1-ol.
| Compound Name | (2S)-4-[[(5-amino-3,3,5-trimethylhex-1-en-2-yl)amino]methyl]-2-methylhex-5-en-1-ol |
|---|---|
| PubChem CID | 146359257 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | (2S)-4-[[(5-amino-3,3,5-trimethylhex-1-en-2-yl)amino]methyl]-2-methylhex-5-en-1-ol |
| SMILES | C=CC(CNC(=C)C(C)(C)CC(C)(C)N)C[C@H](C)CO |
| InChI | InChI=1S/C17H34N2O/c1-8-15(9-13(2)11-20)10-19-14(3)16(4,5)12-17(6,7)18/h8,13,15,19-20H,1,3,9-12,18H2,2,4-7H3/t13-,15?/m0/s1 |
| InChIKey | NKNDADIUXBEDQV-CFMCSPIPSA-N |
| XLogP | 3.06 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|