About 1-fluoro-2,4-dimethyl-1-phenyl-5-[(Z)-prop-1-enyl]-1,3-thiazole
1-fluoro-2,4-dimethyl-1-phenyl-5-[(Z)-prop-1-enyl]-1,3-thiazole (PubChem CID 146359411) has the molecular formula C14H16FNS
and a molecular weight of 249.35 g/mol. Its IUPAC name is 1-fluoro-2,4-dimethyl-1-phenyl-5-[(Z)-prop-1-enyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 1-fluoro-2,4-dimethyl-1-phenyl-5-[(Z)-prop-1-enyl]-1,3-thiazole |
| PubChem CID | 146359411 |
| Molecular Formula | C14H16FNS |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 1-fluoro-2,4-dimethyl-1-phenyl-5-[(Z)-prop-1-enyl]-1,3-thiazole |
| SMILES | C/C=C\C1=C(C)N=C(C)S1(F)c1ccccc1 |
| InChI | InChI=1S/C14H16FNS/c1-4-8-14-11(2)16-12(3)17(14,15)13-9-6-5-7-10-13/h4-10H,1-3H3/b8-4- |
| InChIKey | KNJOFMPLVSCQAU-YWEYNIOJSA-N |
| XLogP | 4.97 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-fluoro-2,4-dimethyl-1-phenyl-5-[(Z)-prop-1-enyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-2,4-dimethyl-1-phenyl-5-[(Z)-prop-1-enyl]-1,3-thiazole?
The IUPAC name of 1-fluoro-2,4-dimethyl-1-phenyl-5-[(Z)-prop-1-enyl]-1,3-thiazole (CID 146359411) is 1-fluoro-2,4-dimethyl-1-phenyl-5-[(Z)-prop-1-enyl]-1,3-thiazole.
What is the SMILES notation for 1-fluoro-2,4-dimethyl-1-phenyl-5-[(Z)-prop-1-enyl]-1,3-thiazole?
The canonical SMILES for 1-fluoro-2,4-dimethyl-1-phenyl-5-[(Z)-prop-1-enyl]-1,3-thiazole is C/C=C\C1=C(C)N=C(C)S1(F)c1ccccc1.
What is the InChIKey of 1-fluoro-2,4-dimethyl-1-phenyl-5-[(Z)-prop-1-enyl]-1,3-thiazole?
The InChIKey is KNJOFMPLVSCQAU-YWEYNIOJSA-N. The full InChI is InChI=1S/C14H16FNS/c1-4-8-14-11(2)16-12(3)17(14,15)13-9-6-5-7-10-13/h4-10H,1-3H3/b8-4-.
What are the key properties of 1-fluoro-2,4-dimethyl-1-phenyl-5-[(Z)-prop-1-enyl]-1,3-thiazole?
1-fluoro-2,4-dimethyl-1-phenyl-5-[(Z)-prop-1-enyl]-1,3-thiazole has a molecular weight of 249.35 g/mol, XLogP of 4.97, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-2,4-dimethyl-1-phenyl-5-[(Z)-prop-1-enyl]-1,3-thiazole is sourced from PubChem (CID 146359411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).