C20H30N2 — CID 146359435
(7Z,9Z)-3-cyclohepta-1,3,6-trien-1-yl-11-ethyl-1,2-dimethyl-1,4-diazacycloundeca-7,9-diene (PubChem CID 146359435) has the molecular formula C20H30N2 and a molecular weight of 298.47 g/mol. Its IUPAC name is (7Z,9Z)-3-cyclohepta-1,3,6-trien-1-yl-11-ethyl-1,2-dimethyl-1,4-diazacycloundeca-7,9-diene.
| Compound Name | (7Z,9Z)-3-cyclohepta-1,3,6-trien-1-yl-11-ethyl-1,2-dimethyl-1,4-diazacycloundeca-7,9-diene |
|---|---|
| PubChem CID | 146359435 |
| Molecular Formula | C20H30N2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | (7Z,9Z)-3-cyclohepta-1,3,6-trien-1-yl-11-ethyl-1,2-dimethyl-1,4-diazacycloundeca-7,9-diene |
| SMILES | CCC1/C=C\C=C/CCNC(C2=CC=CCC=C2)C(C)N1C |
| InChI | InChI=1S/C20H30N2/c1-4-19-15-11-7-8-12-16-21-20(17(2)22(19)3)18-13-9-5-6-10-14-18/h5,7-11,13-15,17,19-21H,4,6,12,16H2,1-3H3/b8-7-,15-11- |
| InChIKey | MWSZDKKPCNWNOR-FGTQOCLDSA-N |
| XLogP | 4.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |