C17H22N2 — CID 146359454
(5Z,7Z)-3-methyl-9-methylidene-2-[(2Z,4E)-octa-2,4,7-trien-4-yl]-4H-1,3-diazonine (PubChem CID 146359454) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is (5Z,7Z)-3-methyl-9-methylidene-2-[(2Z,4E)-octa-2,4,7-trien-4-yl]-4H-1,3-diazonine.
| Compound Name | (5Z,7Z)-3-methyl-9-methylidene-2-[(2Z,4E)-octa-2,4,7-trien-4-yl]-4H-1,3-diazonine |
|---|---|
| PubChem CID | 146359454 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | (5Z,7Z)-3-methyl-9-methylidene-2-[(2Z,4E)-octa-2,4,7-trien-4-yl]-4H-1,3-diazonine |
| SMILES | C=CC/C=C(\C=C/C)C1=N/C(=C)/C=C\C=C/CN\1C |
| InChI | InChI=1S/C17H22N2/c1-5-7-13-16(11-6-2)17-18-15(3)12-9-8-10-14-19(17)4/h5-6,8-13H,1,3,7,14H2,2,4H3/b10-8-,11-6-,12-9-,16-13+,18-17- |
| InChIKey | UHJFWEMRCXGTQB-ICQBICPJSA-N |
| XLogP | 4.03 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|