C18H28N2 — CID 146359455
(3Z,5Z)-7-[[(2E)-2,5-dimethylhepta-2,6-dienylidene]amino]-N-ethylhepta-1,3,5-trien-2-amine (PubChem CID 146359455) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is (3Z,5Z)-7-[[(2E)-2,5-dimethylhepta-2,6-dienylidene]amino]-N-ethylhepta-1,3,5-trien-2-amine.
| Compound Name | (3Z,5Z)-7-[[(2E)-2,5-dimethylhepta-2,6-dienylidene]amino]-N-ethylhepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 146359455 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | (3Z,5Z)-7-[[(2E)-2,5-dimethylhepta-2,6-dienylidene]amino]-N-ethylhepta-1,3,5-trien-2-amine |
| SMILES | C=CC(C)C/C=C(C)/C=N/C/C=C\C=C/C(=C)NCC |
| InChI | InChI=1S/C18H28N2/c1-6-16(3)12-13-17(4)15-19-14-10-8-9-11-18(5)20-7-2/h6,8-11,13,15-16,20H,1,5,7,12,14H2,2-4H3/b10-8-,11-9-,17-13+,19-15+ |
| InChIKey | DDTXVBRQULQFKT-AOODQJNBSA-N |
| XLogP | 4.45 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|