About (3aR)-2-ethyl-3-methyl-6-(trifluoromethyl)-3a,4-dihydroimidazo[4,5-c]pyridine
(3aR)-2-ethyl-3-methyl-6-(trifluoromethyl)-3a,4-dihydroimidazo[4,5-c]pyridine (PubChem CID 146359472) has the molecular formula C10H12F3N3
and a molecular weight of 231.22 g/mol. Its IUPAC name is (3aR)-2-ethyl-3-methyl-6-(trifluoromethyl)-3a,4-dihydroimidazo[4,5-c]pyridine.
Molecular Properties
| Compound Name | (3aR)-2-ethyl-3-methyl-6-(trifluoromethyl)-3a,4-dihydroimidazo[4,5-c]pyridine |
| PubChem CID | 146359472 |
| Molecular Formula | C10H12F3N3 |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | (3aR)-2-ethyl-3-methyl-6-(trifluoromethyl)-3a,4-dihydroimidazo[4,5-c]pyridine |
| SMILES | CCC1=NC2=CC(C(F)(F)F)=NC[C@H]2N1C |
| InChI | InChI=1S/C10H12F3N3/c1-3-9-15-6-4-8(10(11,12)13)14-5-7(6)16(9)2/h4,7H,3,5H2,1-2H3/t7-/m1/s1 |
| InChIKey | SBKWPPYWQHAIGW-SSDOTTSWSA-N |
| XLogP | 2.01 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3aR)-2-ethyl-3-methyl-6-(trifluoromethyl)-3a,4-dihydroimidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3aR)-2-ethyl-3-methyl-6-(trifluoromethyl)-3a,4-dihydroimidazo[4,5-c]pyridine?
The IUPAC name of (3aR)-2-ethyl-3-methyl-6-(trifluoromethyl)-3a,4-dihydroimidazo[4,5-c]pyridine (CID 146359472) is (3aR)-2-ethyl-3-methyl-6-(trifluoromethyl)-3a,4-dihydroimidazo[4,5-c]pyridine.
What is the SMILES notation for (3aR)-2-ethyl-3-methyl-6-(trifluoromethyl)-3a,4-dihydroimidazo[4,5-c]pyridine?
The canonical SMILES for (3aR)-2-ethyl-3-methyl-6-(trifluoromethyl)-3a,4-dihydroimidazo[4,5-c]pyridine is CCC1=NC2=CC(C(F)(F)F)=NC[C@H]2N1C.
What is the InChIKey of (3aR)-2-ethyl-3-methyl-6-(trifluoromethyl)-3a,4-dihydroimidazo[4,5-c]pyridine?
The InChIKey is SBKWPPYWQHAIGW-SSDOTTSWSA-N. The full InChI is InChI=1S/C10H12F3N3/c1-3-9-15-6-4-8(10(11,12)13)14-5-7(6)16(9)2/h4,7H,3,5H2,1-2H3/t7-/m1/s1.
What are the key properties of (3aR)-2-ethyl-3-methyl-6-(trifluoromethyl)-3a,4-dihydroimidazo[4,5-c]pyridine?
(3aR)-2-ethyl-3-methyl-6-(trifluoromethyl)-3a,4-dihydroimidazo[4,5-c]pyridine has a molecular weight of 231.22 g/mol, XLogP of 2.01, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3aR)-2-ethyl-3-methyl-6-(trifluoromethyl)-3a,4-dihydroimidazo[4,5-c]pyridine is sourced from PubChem (CID 146359472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).