C13H19F3N2 — CID 146359505
N-ethyl-N-methyl-N'-[(2E,4E)-4-(trifluoromethyl)octa-2,4,7-trien-2-yl]methanimidamide (PubChem CID 146359505) has the molecular formula C13H19F3N2 and a molecular weight of 260.30 g/mol. Its IUPAC name is N-ethyl-N-methyl-N'-[(2E,4E)-4-(trifluoromethyl)octa-2,4,7-trien-2-yl]methanimidamide.
| Compound Name | N-ethyl-N-methyl-N'-[(2E,4E)-4-(trifluoromethyl)octa-2,4,7-trien-2-yl]methanimidamide |
|---|---|
| PubChem CID | 146359505 |
| Molecular Formula | C13H19F3N2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N-ethyl-N-methyl-N'-[(2E,4E)-4-(trifluoromethyl)octa-2,4,7-trien-2-yl]methanimidamide |
| SMILES | C=CC/C=C(\C=C(C)\N=C\N(C)CC)C(F)(F)F |
| InChI | InChI=1S/C13H19F3N2/c1-5-7-8-12(13(14,15)16)9-11(3)17-10-18(4)6-2/h5,8-10H,1,6-7H2,2-4H3/b11-9+,12-8+,17-10+ |
| InChIKey | MYKIVBNOKWDNJD-PSGJDCHZSA-N |
| XLogP | 3.93 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|