C44H50N2 — CID 146360006
1-(4,4a,9,9a-tetrahydro-3H-carbazol-3-yl)-9-[3-cyclohex-3-en-1-yl-5-(4-methylcyclohexa-1,5-dien-1-yl)cyclohex-2-en-1-yl]-2-methyl-1,2,7,8-tetrahydrocarbazole (PubChem CID 146360006) has the molecular formula C44H50N2 and a molecular weight of 606.90 g/mol. Its IUPAC name is 1-(4,4a,9,9a-tetrahydro-3H-carbazol-3-yl)-9-[3-cyclohex-3-en-1-yl-5-(4-methylcyclohexa-1,5-dien-1-yl)cyclohex-2-en-1-yl]-2-methyl-1,2,7,8-tetrahydrocarbazole.
| Compound Name | 1-(4,4a,9,9a-tetrahydro-3H-carbazol-3-yl)-9-[3-cyclohex-3-en-1-yl-5-(4-methylcyclohexa-1,5-dien-1-yl)cyclohex-2-en-1-yl]-2-methyl-1,2,7,8-tetrahydrocarbazole |
|---|---|
| PubChem CID | 146360006 |
| Molecular Formula | C44H50N2 |
| Molecular Weight | 606.90 g/mol |
| Exact Mass | 606.40 |
| IUPAC Name | 1-(4,4a,9,9a-tetrahydro-3H-carbazol-3-yl)-9-[3-cyclohex-3-en-1-yl-5-(4-methylcyclohexa-1,5-dien-1-yl)cyclohex-2-en-1-yl]-2-methyl-1,2,7,8-tetrahydrocarbazole |
| SMILES | CC1C=CC(C2CC(C3CC=CCC3)=CC(n3c4c(c5c3C(C3C=CC6Nc7ccccc7C6C3)C(C)C=C5)C=CCC4)C2)=CC1 |
| InChI | InChI=1S/C44H50N2/c1-28-16-19-31(20-17-28)34-24-33(30-10-4-3-5-11-30)25-35(26-34)46-42-15-9-7-13-37(42)38-22-18-29(2)43(44(38)46)32-21-23-41-39(27-32)36-12-6-8-14-40(36)45-41/h3-4,6-8,12-14,16,18-23,25,28-30,32,34-35,39,41,43,45H,5,9-11,15,17,24,26-27H2,1-2H3 |
| InChIKey | TZPKIDRMFBBGJZ-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.90 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|