C24H28N4O5S4 — CID 146360553
4-methyl-7-[[(1S)-2-[4-(sulfinoamino)cyclohexa-1,5-dien-1-yl]-1-(2-thiophen-2-yl-2,3-dihydro-1,3-thiazol-4-yl)ethyl]sulfamoyl]-2,3-dihydro-1,4-benzoxazine (PubChem CID 146360553) has the molecular formula C24H28N4O5S4 and a molecular weight of 580.78 g/mol. Its IUPAC name is 4-methyl-7-[[(1S)-2-[4-(sulfinoamino)cyclohexa-1,5-dien-1-yl]-1-(2-thiophen-2-yl-2,3-dihydro-1,3-thiazol-4-yl)ethyl]sulfamoyl]-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 4-methyl-7-[[(1S)-2-[4-(sulfinoamino)cyclohexa-1,5-dien-1-yl]-1-(2-thiophen-2-yl-2,3-dihydro-1,3-thiazol-4-yl)ethyl]sulfamoyl]-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 146360553 |
| Molecular Formula | C24H28N4O5S4 |
| Molecular Weight | 580.78 g/mol |
| Exact Mass | 580.09 |
| IUPAC Name | 4-methyl-7-[[(1S)-2-[4-(sulfinoamino)cyclohexa-1,5-dien-1-yl]-1-(2-thiophen-2-yl-2,3-dihydro-1,3-thiazol-4-yl)ethyl]sulfamoyl]-2,3-dihydro-1,4-benzoxazine |
| SMILES | CN1CCOc2cc(S(=O)(=O)N[C@@H](CC3=CCC(NS(=O)O)C=C3)C3=CSC(c4cccs4)N3)ccc21 |
| InChI | InChI=1S/C24H28N4O5S4/c1-28-10-11-33-22-14-18(8-9-21(22)28)37(31,32)27-19(13-16-4-6-17(7-5-16)26-36(29)30)20-15-35-24(25-20)23-3-2-12-34-23/h2-6,8-9,12,14-15,17,19,24-27H,7,10-11,13H2,1H3,(H,29,30)/t17?,19-,24?/m0/s1 |
| InChIKey | XEGCQPOXYHRBFG-MZXKRHHESA-N |
| XLogP | 3.47 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.78 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|