C48H33N3 — CID 146360657
12-[3-[6-phenyl-2-(3-phenylphenyl)pyrimidin-4-yl]phenyl]-12-azapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),4,6,8,10,14,16,18,20-nonaene (PubChem CID 146360657) has the molecular formula C48H33N3 and a molecular weight of 651.81 g/mol. Its IUPAC name is 12-[3-[6-phenyl-2-(3-phenylphenyl)pyrimidin-4-yl]phenyl]-12-azapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),4,6,8,10,14,16,18,20-nonaene.
| Compound Name | 12-[3-[6-phenyl-2-(3-phenylphenyl)pyrimidin-4-yl]phenyl]-12-azapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),4,6,8,10,14,16,18,20-nonaene |
|---|---|
| PubChem CID | 146360657 |
| Molecular Formula | C48H33N3 |
| Molecular Weight | 651.81 g/mol |
| Exact Mass | 651.27 |
| IUPAC Name | 12-[3-[6-phenyl-2-(3-phenylphenyl)pyrimidin-4-yl]phenyl]-12-azapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),4,6,8,10,14,16,18,20-nonaene |
| SMILES | C1=CC2=CC=C3C(c4c(ccc5ccccc45)N3c3cccc(-c4cc(-c5ccccc5)nc(-c5cccc(-c6ccccc6)c5)n4)c3)C2C=C1 |
| InChI | InChI=1S/C48H33N3/c1-3-13-32(14-4-1)36-19-11-21-38(29-36)48-49-42(35-17-5-2-6-18-35)31-43(50-48)37-20-12-22-39(30-37)51-44-27-25-33-15-7-9-23-40(33)46(44)47-41-24-10-8-16-34(41)26-28-45(47)51/h1-31,40,46H |
| InChIKey | PKWBUDKKEBMGOQ-UHFFFAOYSA-N |
| XLogP | 12.10 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.81 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |