C11H18N2 — CID 146360789
(Z)-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)pent-3-en-2-imine (PubChem CID 146360789) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is (Z)-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)pent-3-en-2-imine.
| Compound Name | (Z)-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)pent-3-en-2-imine |
|---|---|
| PubChem CID | 146360789 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (Z)-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)pent-3-en-2-imine |
| SMILES | C/C=C\C(C)=N\CC1=CCNCC1 |
| InChI | InChI=1S/C11H18N2/c1-3-4-10(2)13-9-11-5-7-12-8-6-11/h3-5,12H,6-9H2,1-2H3/b4-3-,13-10+ |
| InChIKey | CENBDQUVZCJUMI-ANKWKMGHSA-N |
| XLogP | 1.94 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|