C14H23F2N3 — CID 146360791
2-[4-[(1Z)-1-(1,1-difluoropropan-2-ylideneamino)buta-1,3-dienyl]piperidin-1-yl]ethanamine (PubChem CID 146360791) has the molecular formula C14H23F2N3 and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-[4-[(1Z)-1-(1,1-difluoropropan-2-ylideneamino)buta-1,3-dienyl]piperidin-1-yl]ethanamine.
| Compound Name | 2-[4-[(1Z)-1-(1,1-difluoropropan-2-ylideneamino)buta-1,3-dienyl]piperidin-1-yl]ethanamine |
|---|---|
| PubChem CID | 146360791 |
| Molecular Formula | C14H23F2N3 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 2-[4-[(1Z)-1-(1,1-difluoropropan-2-ylideneamino)buta-1,3-dienyl]piperidin-1-yl]ethanamine |
| SMILES | C=C/C=C(\N=C(/C)C(F)F)C1CCN(CCN)CC1 |
| InChI | InChI=1S/C14H23F2N3/c1-3-4-13(18-11(2)14(15)16)12-5-8-19(9-6-12)10-7-17/h3-4,12,14H,1,5-10,17H2,2H3/b13-4-,18-11+ |
| InChIKey | GXWGIKPLGUFMLB-QXJZXBMHSA-N |
| XLogP | 2.45 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|