C20H27N5O2 — CID 146361963
3-methyl-1-[4-[[(3R,4R)-4-methyl-1-prop-2-enoylpiperidin-3-yl]amino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]butan-1-one (PubChem CID 146361963) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is 3-methyl-1-[4-[[(3R,4R)-4-methyl-1-prop-2-enoylpiperidin-3-yl]amino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]butan-1-one.
| Compound Name | 3-methyl-1-[4-[[(3R,4R)-4-methyl-1-prop-2-enoylpiperidin-3-yl]amino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]butan-1-one |
|---|---|
| PubChem CID | 146361963 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 3-methyl-1-[4-[[(3R,4R)-4-methyl-1-prop-2-enoylpiperidin-3-yl]amino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]butan-1-one |
| SMILES | C=CC(=O)N1CC[C@@H](C)[C@@H](Nc2ncnc3[nH]cc(C(=O)CC(C)C)c23)C1 |
| InChI | InChI=1S/C20H27N5O2/c1-5-17(27)25-7-6-13(4)15(10-25)24-20-18-14(16(26)8-12(2)3)9-21-19(18)22-11-23-20/h5,9,11-13,15H,1,6-8,10H2,2-4H3,(H2,21,22,23,24)/t13-,15+/m1/s1 |
| InChIKey | SAEMXGHHYVEIOJ-HIFRSBDPSA-N |
| XLogP | 3.02 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|